C19H22O3 — CID 82141396
2-(3-methoxyphenyl)-3-(2,4,6-trimethylphenyl)propanoic acid (PubChem CID 82141396) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-3-(2,4,6-trimethylphenyl)propanoic acid.
| Compound Name | 2-(3-methoxyphenyl)-3-(2,4,6-trimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 82141396 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-(3-methoxyphenyl)-3-(2,4,6-trimethylphenyl)propanoic acid |
| SMILES | COc1cccc(C(Cc2c(C)cc(C)cc2C)C(=O)O)c1 |
| InChI | InChI=1S/C19H22O3/c1-12-8-13(2)17(14(3)9-12)11-18(19(20)21)15-6-5-7-16(10-15)22-4/h5-10,18H,11H2,1-4H3,(H,20,21) |
| InChIKey | JQRHBJUMODMJHH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |