3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid

C19H22O3 — CID 82141118

IUPAC3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid
SMILESCOc1cccc(CC(C(=O)O)c2c(C)cc(C)cc2C)c1
InChIInChI=1S/C19H22O3/c1-12-8-13(2)18(14(3)9-12)17(19(20)21)11-15-6-5-7-16(10-15)22-4/h5-10,17H,11H2,1-4H3,(H,20,21)
InChIKeyWRPJJIYJJYXRKF-UHFFFAOYSA-N
MW298.38 g/mol
LogP4.03
Rot. Bonds5

About 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid

3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid (PubChem CID 82141118) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid.

Molecular Properties

Compound Name3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid
PubChem CID82141118
Molecular FormulaC19H22O3
Molecular Weight298.38 g/mol
Exact Mass298.16
IUPAC Name3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid
SMILESCOc1cccc(CC(C(=O)O)c2c(C)cc(C)cc2C)c1
InChIInChI=1S/C19H22O3/c1-12-8-13(2)18(14(3)9-12)17(19(20)21)11-15-6-5-7-16(10-15)22-4/h5-10,17H,11H2,1-4H3,(H,20,21)
InChIKeyWRPJJIYJJYXRKF-UHFFFAOYSA-N
XLogP4.03
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.38
LogP ≤ 54.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid?
The IUPAC name of 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid (CID 82141118) is 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid.
What is the SMILES notation for 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid?
The canonical SMILES for 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid is COc1cccc(CC(C(=O)O)c2c(C)cc(C)cc2C)c1.
What is the InChIKey of 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid?
The InChIKey is WRPJJIYJJYXRKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O3/c1-12-8-13(2)18(14(3)9-12)17(19(20)21)11-15-6-5-7-16(10-15)22-4/h5-10,17H,11H2,1-4H3,(H,20,21).
What are the key properties of 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid?
3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid has a molecular weight of 298.38 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxyphenyl)-2-(2,4,6-trimethylphenyl)propanoic acid is sourced from PubChem (CID 82141118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).