C10H12O3S — CID 117243551
2-(3-methoxyphenyl)-3-sulfanylpropanoic acid (PubChem CID 117243551) has the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-3-sulfanylpropanoic acid.
| Compound Name | 2-(3-methoxyphenyl)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 117243551 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2-(3-methoxyphenyl)-3-sulfanylpropanoic acid |
| SMILES | COc1cccc(C(CS)C(=O)O)c1 |
| InChI | InChI=1S/C10H12O3S/c1-13-8-4-2-3-7(5-8)9(6-14)10(11)12/h2-5,9,14H,6H2,1H3,(H,11,12) |
| InChIKey | ODPPMWJGUITDQK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|