C17H14Cl2O4 — CID 167567818
2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid (PubChem CID 167567818) has the molecular formula C17H14Cl2O4 and a molecular weight of 353.20 g/mol. Its IUPAC name is 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid.
| Compound Name | 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid |
|---|---|
| PubChem CID | 167567818 |
| Molecular Formula | C17H14Cl2O4 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid |
| SMILES | COc1cccc(CCC(=O)c2cc(Cl)c(C(=O)O)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H14Cl2O4/c1-23-12-4-2-3-10(7-12)5-6-15(20)11-8-13(18)16(17(21)22)14(19)9-11/h2-4,7-9H,5-6H2,1H3,(H,21,22) |
| InChIKey | RFEGGPZCTKBHRF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |