2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid

C17H14Cl2O4 — CID 167567818

IUPAC2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid
SMILESCOc1cccc(CCC(=O)c2cc(Cl)c(C(=O)O)c(Cl)c2)c1
InChIInChI=1S/C17H14Cl2O4/c1-23-12-4-2-3-10(7-12)5-6-15(20)11-8-13(18)16(17(21)22)14(19)9-11/h2-4,7-9H,5-6H2,1H3,(H,21,22)
InChIKeyRFEGGPZCTKBHRF-UHFFFAOYSA-N
MW353.20 g/mol
LogP4.52
Rot. Bonds6

About 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid

2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid (PubChem CID 167567818) has the molecular formula C17H14Cl2O4 and a molecular weight of 353.20 g/mol. Its IUPAC name is 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid.

Molecular Properties

Compound Name2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid
PubChem CID167567818
Molecular FormulaC17H14Cl2O4
Molecular Weight353.20 g/mol
Exact Mass352.03
IUPAC Name2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid
SMILESCOc1cccc(CCC(=O)c2cc(Cl)c(C(=O)O)c(Cl)c2)c1
InChIInChI=1S/C17H14Cl2O4/c1-23-12-4-2-3-10(7-12)5-6-15(20)11-8-13(18)16(17(21)22)14(19)9-11/h2-4,7-9H,5-6H2,1H3,(H,21,22)
InChIKeyRFEGGPZCTKBHRF-UHFFFAOYSA-N
XLogP4.52
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.20
LogP ≤ 54.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid?
The IUPAC name of 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid (CID 167567818) is 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid.
What is the SMILES notation for 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid?
The canonical SMILES for 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid is COc1cccc(CCC(=O)c2cc(Cl)c(C(=O)O)c(Cl)c2)c1.
What is the InChIKey of 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid?
The InChIKey is RFEGGPZCTKBHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2O4/c1-23-12-4-2-3-10(7-12)5-6-15(20)11-8-13(18)16(17(21)22)14(19)9-11/h2-4,7-9H,5-6H2,1H3,(H,21,22).
What are the key properties of 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid?
2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid has a molecular weight of 353.20 g/mol, XLogP of 4.52, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-[3-(3-methoxyphenyl)propanoyl]benzoic acid is sourced from PubChem (CID 167567818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).