C17H17Cl2O4P — CID 175512520
2,6-dichloro-4-[2-[(3-methoxyphenyl)-methylphosphoryl]ethyl]benzoic acid (PubChem CID 175512520) has the molecular formula C17H17Cl2O4P and a molecular weight of 387.20 g/mol. Its IUPAC name is 2,6-dichloro-4-[2-[(3-methoxyphenyl)-methylphosphoryl]ethyl]benzoic acid.
| Compound Name | 2,6-dichloro-4-[2-[(3-methoxyphenyl)-methylphosphoryl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175512520 |
| Molecular Formula | C17H17Cl2O4P |
| Molecular Weight | 387.20 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2,6-dichloro-4-[2-[(3-methoxyphenyl)-methylphosphoryl]ethyl]benzoic acid |
| SMILES | COc1cccc(P(C)(=O)CCc2cc(Cl)c(C(=O)O)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H17Cl2O4P/c1-23-12-4-3-5-13(10-12)24(2,22)7-6-11-8-14(18)16(17(20)21)15(19)9-11/h3-5,8-10H,6-7H2,1-2H3,(H,20,21) |
| InChIKey | YRNOZAXOZKUAEG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.20 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|