C18H19Cl2O6P — CID 137391220
methyl 2,6-dichloro-4-[1-hydroxy-2-[methoxy-(3-methoxyphenyl)phosphoryl]ethyl]benzoate (PubChem CID 137391220) has the molecular formula C18H19Cl2O6P and a molecular weight of 433.22 g/mol. Its IUPAC name is methyl 2,6-dichloro-4-[1-hydroxy-2-[methoxy-(3-methoxyphenyl)phosphoryl]ethyl]benzoate.
| Compound Name | methyl 2,6-dichloro-4-[1-hydroxy-2-[methoxy-(3-methoxyphenyl)phosphoryl]ethyl]benzoate |
|---|---|
| PubChem CID | 137391220 |
| Molecular Formula | C18H19Cl2O6P |
| Molecular Weight | 433.22 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | methyl 2,6-dichloro-4-[1-hydroxy-2-[methoxy-(3-methoxyphenyl)phosphoryl]ethyl]benzoate |
| SMILES | COC(=O)c1c(Cl)cc(C(O)CP(=O)(OC)c2cccc(OC)c2)cc1Cl |
| InChI | InChI=1S/C18H19Cl2O6P/c1-24-12-5-4-6-13(9-12)27(23,26-3)10-16(21)11-7-14(19)17(15(20)8-11)18(22)25-2/h4-9,16,21H,10H2,1-3H3 |
| InChIKey | XSLKWLFNPOFJEN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|