C17H15Cl2NO3 — CID 166506945
methyl 2,6-dichloro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate (PubChem CID 166506945) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is methyl 2,6-dichloro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate.
| Compound Name | methyl 2,6-dichloro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 166506945 |
| Molecular Formula | C17H15Cl2NO3 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | methyl 2,6-dichloro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1c(Cl)cc(C(=O)N[C@H](C)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C17H15Cl2NO3/c1-10(11-6-4-3-5-7-11)20-16(21)12-8-13(18)15(14(19)9-12)17(22)23-2/h3-10H,1-2H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | NQQKCOANXBFXQF-SNVBAGLBSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |