C18H19NO6S — CID 91468652
methyl 3-methylsulfonyloxy-5-(1-phenylethylcarbamoyl)benzoate (PubChem CID 91468652) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is methyl 3-methylsulfonyloxy-5-(1-phenylethylcarbamoyl)benzoate.
| Compound Name | methyl 3-methylsulfonyloxy-5-(1-phenylethylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 91468652 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | methyl 3-methylsulfonyloxy-5-(1-phenylethylcarbamoyl)benzoate |
| SMILES | COC(=O)c1cc(OS(C)(=O)=O)cc(C(=O)NC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C18H19NO6S/c1-12(13-7-5-4-6-8-13)19-17(20)14-9-15(18(21)24-2)11-16(10-14)25-26(3,22)23/h4-12H,1-3H3,(H,19,20) |
| InChIKey | YETQVVUZAFEHGM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|