methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate

C17H15F2NO3 — CID 151768789

IUPACmethyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate
SMILESCOC(=O)c1c(F)cc(C(=O)N[C@H](C)c2ccccc2)cc1F
InChIInChI=1S/C17H15F2NO3/c1-10(11-6-4-3-5-7-11)20-16(21)12-8-13(18)15(14(19)9-12)17(22)23-2/h3-10H,1-2H3,(H,20,21)/t10-/m1/s1
InChIKeyRSDSXWYIKQNWAB-SNVBAGLBSA-N
MW319.31 g/mol
LogP3.24
Rot. Bonds4

About methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate

methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate (PubChem CID 151768789) has the molecular formula C17H15F2NO3 and a molecular weight of 319.31 g/mol. Its IUPAC name is methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate.

Molecular Properties

Compound Namemethyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate
PubChem CID151768789
Molecular FormulaC17H15F2NO3
Molecular Weight319.31 g/mol
Exact Mass319.10
IUPAC Namemethyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate
SMILESCOC(=O)c1c(F)cc(C(=O)N[C@H](C)c2ccccc2)cc1F
InChIInChI=1S/C17H15F2NO3/c1-10(11-6-4-3-5-7-11)20-16(21)12-8-13(18)15(14(19)9-12)17(22)23-2/h3-10H,1-2H3,(H,20,21)/t10-/m1/s1
InChIKeyRSDSXWYIKQNWAB-SNVBAGLBSA-N
XLogP3.24
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.31
LogP ≤ 53.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate?
The IUPAC name of methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate (CID 151768789) is methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate.
What is the SMILES notation for methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate?
The canonical SMILES for methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate is COC(=O)c1c(F)cc(C(=O)N[C@H](C)c2ccccc2)cc1F.
What is the InChIKey of methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate?
The InChIKey is RSDSXWYIKQNWAB-SNVBAGLBSA-N. The full InChI is InChI=1S/C17H15F2NO3/c1-10(11-6-4-3-5-7-11)20-16(21)12-8-13(18)15(14(19)9-12)17(22)23-2/h3-10H,1-2H3,(H,20,21)/t10-/m1/s1.
What are the key properties of methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate?
methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate has a molecular weight of 319.31 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-difluoro-4-[[(1R)-1-phenylethyl]carbamoyl]benzoate is sourced from PubChem (CID 151768789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).