C15H12F3NO — CID 63188112
3,4,5-trifluoro-N-(1-phenylethyl)benzamide (PubChem CID 63188112) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-(1-phenylethyl)benzamide.
| Compound Name | 3,4,5-trifluoro-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 63188112 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3,4,5-trifluoro-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(F)c(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C15H12F3NO/c1-9(10-5-3-2-4-6-10)19-15(20)11-7-12(16)14(18)13(17)8-11/h2-9H,1H3,(H,19,20) |
| InChIKey | BNKSVAOKAWRZBE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|