C15H11ClF3NO — CID 114300143
N-(2-chloro-1-phenylethyl)-3,4,5-trifluorobenzamide (PubChem CID 114300143) has the molecular formula C15H11ClF3NO and a molecular weight of 313.71 g/mol. Its IUPAC name is N-(2-chloro-1-phenylethyl)-3,4,5-trifluorobenzamide.
| Compound Name | N-(2-chloro-1-phenylethyl)-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 114300143 |
| Molecular Formula | C15H11ClF3NO |
| Molecular Weight | 313.71 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-(2-chloro-1-phenylethyl)-3,4,5-trifluorobenzamide |
| SMILES | O=C(NC(CCl)c1ccccc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H11ClF3NO/c16-8-13(9-4-2-1-3-5-9)20-15(21)10-6-11(17)14(19)12(18)7-10/h1-7,13H,8H2,(H,20,21) |
| InChIKey | WWEHMMGHIPEFFJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|