C33H33N3O6 — CID 139248401
1-N,3-N,5-N-tris(2-hydroxy-1-phenylethyl)benzene-1,3,5-tricarboxamide (PubChem CID 139248401) has the molecular formula C33H33N3O6 and a molecular weight of 567.64 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(2-hydroxy-1-phenylethyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(2-hydroxy-1-phenylethyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 139248401 |
| Molecular Formula | C33H33N3O6 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | 1-N,3-N,5-N-tris(2-hydroxy-1-phenylethyl)benzene-1,3,5-tricarboxamide |
| SMILES | O=C(NC(CO)c1ccccc1)c1cc(C(=O)NC(CO)c2ccccc2)cc(C(=O)NC(CO)c2ccccc2)c1 |
| InChI | InChI=1S/C33H33N3O6/c37-19-28(22-10-4-1-5-11-22)34-31(40)25-16-26(32(41)35-29(20-38)23-12-6-2-7-13-23)18-27(17-25)33(42)36-30(21-39)24-14-8-3-9-15-24/h1-18,28-30,37-39H,19-21H2,(H,34,40)(H,35,41)(H,36,42) |
| InChIKey | OTGMXZDGLLARQR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |