C17H16NO5PS — CID 159120234
5-(1-phenylethylcarbamoyl)benzene-1,3-dicarboxylic acid;sulfanylidenephosphane (PubChem CID 159120234) has the molecular formula C17H16NO5PS and a molecular weight of 377.36 g/mol. Its IUPAC name is 5-(1-phenylethylcarbamoyl)benzene-1,3-dicarboxylic acid;sulfanylidenephosphane.
| Compound Name | 5-(1-phenylethylcarbamoyl)benzene-1,3-dicarboxylic acid;sulfanylidenephosphane |
|---|---|
| PubChem CID | 159120234 |
| Molecular Formula | C17H16NO5PS |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 5-(1-phenylethylcarbamoyl)benzene-1,3-dicarboxylic acid;sulfanylidenephosphane |
| SMILES | CC(NC(=O)c1cc(C(=O)O)cc(C(=O)O)c1)c1ccccc1.P=S |
| InChI | InChI=1S/C17H15NO5.HPS/c1-10(11-5-3-2-4-6-11)18-15(19)12-7-13(16(20)21)9-14(8-12)17(22)23;1-2/h2-10H,1H3,(H,18,19)(H,20,21)(H,22,23);1H |
| InChIKey | KFPIETXRQKIDNU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|