C19H21N3O4 — CID 59298009
methyl 3-(methylcarbamoylamino)-5-[[(1R)-1-phenylethyl]carbamoyl]benzoate (PubChem CID 59298009) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is methyl 3-(methylcarbamoylamino)-5-[[(1R)-1-phenylethyl]carbamoyl]benzoate.
| Compound Name | methyl 3-(methylcarbamoylamino)-5-[[(1R)-1-phenylethyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 59298009 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | methyl 3-(methylcarbamoylamino)-5-[[(1R)-1-phenylethyl]carbamoyl]benzoate |
| SMILES | CNC(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-12(13-7-5-4-6-8-13)21-17(23)14-9-15(18(24)26-3)11-16(10-14)22-19(25)20-2/h4-12H,1-3H3,(H,21,23)(H2,20,22,25)/t12-/m1/s1 |
| InChIKey | RRMMIKYODGKQEA-GFCCVEGCSA-N |
| XLogP | 2.72 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |