C29H26N2O10 — CID 3394738
dimethyl 5-[[3-[3,5-bis(methoxycarbonyl)anilino]-3-oxo-2-phenylpropanoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 3394738) has the molecular formula C29H26N2O10 and a molecular weight of 562.53 g/mol. Its IUPAC name is dimethyl 5-[[3-[3,5-bis(methoxycarbonyl)anilino]-3-oxo-2-phenylpropanoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[3-[3,5-bis(methoxycarbonyl)anilino]-3-oxo-2-phenylpropanoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3394738 |
| Molecular Formula | C29H26N2O10 |
| Molecular Weight | 562.53 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | dimethyl 5-[[3-[3,5-bis(methoxycarbonyl)anilino]-3-oxo-2-phenylpropanoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)C(C(=O)Nc2cc(C(=O)OC)cc(C(=O)OC)c2)c2ccccc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C29H26N2O10/c1-38-26(34)17-10-18(27(35)39-2)13-21(12-17)30-24(32)23(16-8-6-5-7-9-16)25(33)31-22-14-19(28(36)40-3)11-20(15-22)29(37)41-4/h5-15,23H,1-4H3,(H,30,32)(H,31,33) |
| InChIKey | YQEONJSHVPGHCZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|