C19H19NO5S — CID 2210400
dimethyl 5-[(2-ethylsulfanylbenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 2210400) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is dimethyl 5-[(2-ethylsulfanylbenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2-ethylsulfanylbenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2210400 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | dimethyl 5-[(2-ethylsulfanylbenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | CCSc1ccccc1C(=O)Nc1cc(C(=O)OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H19NO5S/c1-4-26-16-8-6-5-7-15(16)17(21)20-14-10-12(18(22)24-2)9-13(11-14)19(23)25-3/h5-11H,4H2,1-3H3,(H,20,21) |
| InChIKey | OUHMPNVUXHQXHO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |