C24H20O6 — CID 2463089
dimethyl 5-(2,2-diphenylacetyl)oxybenzene-1,3-dicarboxylate (PubChem CID 2463089) has the molecular formula C24H20O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is dimethyl 5-(2,2-diphenylacetyl)oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(2,2-diphenylacetyl)oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 2463089 |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | dimethyl 5-(2,2-diphenylacetyl)oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)C(c2ccccc2)c2ccccc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C24H20O6/c1-28-22(25)18-13-19(23(26)29-2)15-20(14-18)30-24(27)21(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-15,21H,1-2H3 |
| InChIKey | PIPBPBNLESCGBT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|