C20H16O8 — CID 130409788
dimethyl 5-[(E)-4-oxo-4-phenoxybut-2-enoyl]oxybenzene-1,3-dicarboxylate (PubChem CID 130409788) has the molecular formula C20H16O8 and a molecular weight of 384.34 g/mol. Its IUPAC name is dimethyl 5-[(E)-4-oxo-4-phenoxybut-2-enoyl]oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(E)-4-oxo-4-phenoxybut-2-enoyl]oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 130409788 |
| Molecular Formula | C20H16O8 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | dimethyl 5-[(E)-4-oxo-4-phenoxybut-2-enoyl]oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)/C=C/C(=O)Oc2ccccc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H16O8/c1-25-19(23)13-10-14(20(24)26-2)12-16(11-13)28-18(22)9-8-17(21)27-15-6-4-3-5-7-15/h3-12H,1-2H3/b9-8+ |
| InChIKey | UIXXETFLABQAII-CMDGGOBGSA-N |
| XLogP | 2.33 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|