C19H15ClO6 — CID 8018296
dimethyl 5-[(E)-3-(2-chlorophenyl)prop-2-enoyl]oxybenzene-1,3-dicarboxylate (PubChem CID 8018296) has the molecular formula C19H15ClO6 and a molecular weight of 374.78 g/mol. Its IUPAC name is dimethyl 5-[(E)-3-(2-chlorophenyl)prop-2-enoyl]oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(E)-3-(2-chlorophenyl)prop-2-enoyl]oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8018296 |
| Molecular Formula | C19H15ClO6 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | dimethyl 5-[(E)-3-(2-chlorophenyl)prop-2-enoyl]oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)/C=C/c2ccccc2Cl)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H15ClO6/c1-24-18(22)13-9-14(19(23)25-2)11-15(10-13)26-17(21)8-7-12-5-3-4-6-16(12)20/h3-11H,1-2H3/b8-7+ |
| InChIKey | ZKRPSTGTGKCDSK-BQYQJAHWSA-N |
| XLogP | 3.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|