C19H17NO7S — CID 9456486
dimethyl 5-[2-(2-amino-2-oxoethyl)sulfanylbenzoyl]oxybenzene-1,3-dicarboxylate (PubChem CID 9456486) has the molecular formula C19H17NO7S and a molecular weight of 403.41 g/mol. Its IUPAC name is dimethyl 5-[2-(2-amino-2-oxoethyl)sulfanylbenzoyl]oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-(2-amino-2-oxoethyl)sulfanylbenzoyl]oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 9456486 |
| Molecular Formula | C19H17NO7S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | dimethyl 5-[2-(2-amino-2-oxoethyl)sulfanylbenzoyl]oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)c2ccccc2SCC(N)=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H17NO7S/c1-25-17(22)11-7-12(18(23)26-2)9-13(8-11)27-19(24)14-5-3-4-6-15(14)28-10-16(20)21/h3-9H,10H2,1-2H3,(H2,20,21) |
| InChIKey | CTSXRFOUVWQWLT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|