C19H14O7 — CID 8018328
dimethyl 5-(1-benzofuran-2-carbonyloxy)benzene-1,3-dicarboxylate (PubChem CID 8018328) has the molecular formula C19H14O7 and a molecular weight of 354.31 g/mol. Its IUPAC name is dimethyl 5-(1-benzofuran-2-carbonyloxy)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(1-benzofuran-2-carbonyloxy)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8018328 |
| Molecular Formula | C19H14O7 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | dimethyl 5-(1-benzofuran-2-carbonyloxy)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)c2cc3ccccc3o2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H14O7/c1-23-17(20)12-7-13(18(21)24-2)9-14(8-12)25-19(22)16-10-11-5-3-4-6-15(11)26-16/h3-10H,1-2H3 |
| InChIKey | QLKIZTCWGDNTDA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|