C21H15O4- — CID 6956217
4-(2,2-diphenylacetyl)oxybenzoate (PubChem CID 6956217) has the molecular formula C21H15O4- and a molecular weight of 331.35 g/mol. Its IUPAC name is 4-(2,2-diphenylacetyl)oxybenzoate.
| Compound Name | 4-(2,2-diphenylacetyl)oxybenzoate |
|---|---|
| PubChem CID | 6956217 |
| Molecular Formula | C21H15O4- |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 4-(2,2-diphenylacetyl)oxybenzoate |
| SMILES | O=C([O-])c1ccc(OC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16O4/c22-20(23)17-11-13-18(14-12-17)25-21(24)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,19H,(H,22,23)/p-1 |
| InChIKey | JCMNSAAYXTXFKN-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|