C21H16N4O2 — CID 4815617
[4-(tetrazol-1-yl)phenyl] 2,2-diphenylacetate (PubChem CID 4815617) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is [4-(tetrazol-1-yl)phenyl] 2,2-diphenylacetate.
| Compound Name | [4-(tetrazol-1-yl)phenyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 4815617 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [4-(tetrazol-1-yl)phenyl] 2,2-diphenylacetate |
| SMILES | O=C(Oc1ccc(-n2cnnn2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N4O2/c26-21(27-19-13-11-18(12-14-19)25-15-22-23-24-25)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-15,20H |
| InChIKey | TUSJBGGDCHBVPW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|