About [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate
[4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 27674834) has the molecular formula C18H13N5O2S
and a molecular weight of 363.40 g/mol. Its IUPAC name is [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 27674834 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)Oc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C18H13N5O2S/c1-12-16(26-17(20-12)13-5-3-2-4-6-13)18(24)25-15-9-7-14(8-10-15)23-11-19-21-22-23/h2-11H,1H3 |
| InChIKey | IXGUHESIKCHDNQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate?
The IUPAC name of [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate (CID 27674834) is [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate is Cc1nc(-c2ccccc2)sc1C(=O)Oc1ccc(-n2cnnn2)cc1.
What is the InChIKey of [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate?
The InChIKey is IXGUHESIKCHDNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N5O2S/c1-12-16(26-17(20-12)13-5-3-2-4-6-13)18(24)25-15-9-7-14(8-10-15)23-11-19-21-22-23/h2-11H,1H3.
What are the key properties of [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate?
[4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate has a molecular weight of 363.40 g/mol, XLogP of 3.31, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(tetrazol-1-yl)phenyl] 4-methyl-2-phenyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 27674834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).