C22H20N2O3S — CID 171477170
phenyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 171477170) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is phenyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | phenyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 171477170 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | phenyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccc(OCC(C)C)c(C#N)c2)sc1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C22H20N2O3S/c1-14(2)13-26-19-10-9-16(11-17(19)12-23)21-24-15(3)20(28-21)22(25)27-18-7-5-4-6-8-18/h4-11,14H,13H2,1-3H3 |
| InChIKey | OOAJWIBORWWODK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|