C24H24N4O2S — CID 172511048
2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-[(E)-(2-methylphenyl)methylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 172511048) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-[(E)-(2-methylphenyl)methylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-[(E)-(2-methylphenyl)methylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 172511048 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-N-[(E)-(2-methylphenyl)methylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccccc1/C=N/NC(=O)c1sc(-c2ccc(OCC(C)C)c(C#N)c2)nc1C |
| InChI | InChI=1S/C24H24N4O2S/c1-15(2)14-30-21-10-9-18(11-20(21)12-25)24-27-17(4)22(31-24)23(29)28-26-13-19-8-6-5-7-16(19)3/h5-11,13,15H,14H2,1-4H3,(H,28,29)/b26-13+ |
| InChIKey | COQPVDMMNIZOIY-LGJNPRDNSA-N |
| XLogP | 5.10 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|