C25H25N3O7S2 — CID 144982128
1-(4-sulfamoylbenzoyl)oxyethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 144982128) has the molecular formula C25H25N3O7S2 and a molecular weight of 543.62 g/mol. Its IUPAC name is 1-(4-sulfamoylbenzoyl)oxyethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | 1-(4-sulfamoylbenzoyl)oxyethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 144982128 |
| Molecular Formula | C25H25N3O7S2 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 1-(4-sulfamoylbenzoyl)oxyethyl 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccc(OCC(C)C)c(C#N)c2)sc1C(=O)OC(C)OC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C25H25N3O7S2/c1-14(2)13-33-21-10-7-18(11-19(21)12-26)23-28-15(3)22(36-23)25(30)35-16(4)34-24(29)17-5-8-20(9-6-17)37(27,31)32/h5-11,14,16H,13H2,1-4H3,(H2,27,31,32) |
| InChIKey | KYMNAOGCMXEOCL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 158.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|