C21H21N3O2S — CID 110338438
4-methyl-2-phenyl-N-[(E)-(2-propoxyphenyl)methylideneamino]-1,3-thiazole-5-carboxamide (PubChem CID 110338438) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is 4-methyl-2-phenyl-N-[(E)-(2-propoxyphenyl)methylideneamino]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-phenyl-N-[(E)-(2-propoxyphenyl)methylideneamino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110338438 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-methyl-2-phenyl-N-[(E)-(2-propoxyphenyl)methylideneamino]-1,3-thiazole-5-carboxamide |
| SMILES | CCCOc1ccccc1/C=N/NC(=O)c1sc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C21H21N3O2S/c1-3-13-26-18-12-8-7-11-17(18)14-22-24-20(25)19-15(2)23-21(27-19)16-9-5-4-6-10-16/h4-12,14H,3,13H2,1-2H3,(H,24,25)/b22-14+ |
| InChIKey | FZBIQRPKWSYZPS-HYARGMPZSA-N |
| XLogP | 4.67 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|