C25H20FN3O2S — CID 110339422
N-[(E)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 110339422) has the molecular formula C25H20FN3O2S and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[(E)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(E)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110339422 |
| Molecular Formula | C25H20FN3O2S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-[(E)-[3-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-methyl-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)N/N=C/c1cccc(OCc2ccccc2F)c1 |
| InChI | InChI=1S/C25H20FN3O2S/c1-17-23(32-25(28-17)19-9-3-2-4-10-19)24(30)29-27-15-18-8-7-12-21(14-18)31-16-20-11-5-6-13-22(20)26/h2-15H,16H2,1H3,(H,29,30)/b27-15+ |
| InChIKey | ZECNLIVJUIMAMM-JFLMPSFJSA-N |
| XLogP | 5.60 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|