C19H17N3OS — CID 39024482
2-benzyl-N-[(E)-benzylideneamino]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 39024482) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 2-benzyl-N-[(E)-benzylideneamino]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-benzyl-N-[(E)-benzylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39024482 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 2-benzyl-N-[(E)-benzylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(Cc2ccccc2)sc1C(=O)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C19H17N3OS/c1-14-18(19(23)22-20-13-16-10-6-3-7-11-16)24-17(21-14)12-15-8-4-2-5-9-15/h2-11,13H,12H2,1H3,(H,22,23)/b20-13+ |
| InChIKey | WWIDPIOUNXCZEB-DEDYPNTBSA-N |
| XLogP | 3.81 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|