C23H26N4OS — CID 39024471
2-benzyl-N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 39024471) has the molecular formula C23H26N4OS and a molecular weight of 406.56 g/mol. Its IUPAC name is 2-benzyl-N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-benzyl-N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 39024471 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-benzyl-N-[(E)-[4-(diethylamino)phenyl]methylideneamino]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)c1ccc(/C=N/NC(=O)c2sc(Cc3ccccc3)nc2C)cc1 |
| InChI | InChI=1S/C23H26N4OS/c1-4-27(5-2)20-13-11-19(12-14-20)16-24-26-23(28)22-17(3)25-21(29-22)15-18-9-7-6-8-10-18/h6-14,16H,4-5,15H2,1-3H3,(H,26,28)/b24-16+ |
| InChIKey | KZIVNPUEEFHUFD-LFVJCYFKSA-N |
| XLogP | 4.65 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|