C22H24N4O — CID 6110691
N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-methylquinoline-3-carboxamide (PubChem CID 6110691) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-methylquinoline-3-carboxamide.
| Compound Name | N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 6110691 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-methylquinoline-3-carboxamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)c2cc3ccccc3nc2C)cc1 |
| InChI | InChI=1S/C22H24N4O/c1-4-26(5-2)19-12-10-17(11-13-19)15-23-25-22(27)20-14-18-8-6-7-9-21(18)24-16(20)3/h6-15H,4-5H2,1-3H3,(H,25,27)/b23-15- |
| InChIKey | JSAWLJCPXXMEJH-HAHDFKILSA-N |
| XLogP | 4.15 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|