C18H14BrN3O2 — CID 3835530
N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-methylquinoline-3-carboxamide (PubChem CID 3835530) has the molecular formula C18H14BrN3O2 and a molecular weight of 384.23 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-methylquinoline-3-carboxamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 3835530 |
| Molecular Formula | C18H14BrN3O2 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-methylquinoline-3-carboxamide |
| SMILES | Cc1nc2ccccc2cc1C(=O)NN=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C18H14BrN3O2/c1-11-15(9-12-4-2-3-5-16(12)21-11)18(24)22-20-10-13-8-14(19)6-7-17(13)23/h2-10,23H,1H3,(H,22,24) |
| InChIKey | ZEYNMOZUDYXISN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|