C20H19N3O3 — CID 6875795
N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-2-methylquinoline-3-carboxamide (PubChem CID 6875795) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-2-methylquinoline-3-carboxamide.
| Compound Name | N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-2-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 6875795 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-2-methylquinoline-3-carboxamide |
| SMILES | COc1ccc(OC)c(/C=N/NC(=O)c2cc3ccccc3nc2C)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-13-17(11-14-6-4-5-7-18(14)22-13)20(24)23-21-12-15-10-16(25-2)8-9-19(15)26-3/h4-12H,1-3H3,(H,23,24)/b21-12+ |
| InChIKey | YEKATJQEDQUBDC-CIAFOILYSA-N |
| XLogP | 3.32 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|