C24H18BrN3O2S — CID 2247767
5-bromo-2-hydroxy-N-[[2-(4-methylphenyl)sulfanylquinolin-3-yl]methylideneamino]benzamide (PubChem CID 2247767) has the molecular formula C24H18BrN3O2S and a molecular weight of 492.40 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[[2-(4-methylphenyl)sulfanylquinolin-3-yl]methylideneamino]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[[2-(4-methylphenyl)sulfanylquinolin-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 2247767 |
| Molecular Formula | C24H18BrN3O2S |
| Molecular Weight | 492.40 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[[2-(4-methylphenyl)sulfanylquinolin-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(Sc2nc3ccccc3cc2C=NNC(=O)c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C24H18BrN3O2S/c1-15-6-9-19(10-7-15)31-24-17(12-16-4-2-3-5-21(16)27-24)14-26-28-23(30)20-13-18(25)8-11-22(20)29/h2-14,29H,1H3,(H,28,30) |
| InChIKey | PUGYPDKTJMTKGU-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.40 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|