C20H17Cl2N3O2S — CID 110340632
N-[(E)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 110340632) has the molecular formula C20H17Cl2N3O2S and a molecular weight of 434.35 g/mol. Its IUPAC name is N-[(E)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(E)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110340632 |
| Molecular Formula | C20H17Cl2N3O2S |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | N-[(E)-[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)N/N=C/c2cccc(OCc3ccc(Cl)cc3Cl)c2)s1 |
| InChI | InChI=1S/C20H17Cl2N3O2S/c1-12-19(28-13(2)24-12)20(26)25-23-10-14-4-3-5-17(8-14)27-11-15-6-7-16(21)9-18(15)22/h3-10H,11H2,1-2H3,(H,25,26)/b23-10+ |
| InChIKey | UVUBUZFUEWVBBW-AUEPDCJTSA-N |
| XLogP | 5.41 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|