C25H21NO7 — CID 55456118
dimethyl 5-(2-benzamido-2-phenylacetyl)oxybenzene-1,3-dicarboxylate (PubChem CID 55456118) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is dimethyl 5-(2-benzamido-2-phenylacetyl)oxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(2-benzamido-2-phenylacetyl)oxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55456118 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | dimethyl 5-(2-benzamido-2-phenylacetyl)oxybenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)C(NC(=O)c2ccccc2)c2ccccc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C25H21NO7/c1-31-23(28)18-13-19(24(29)32-2)15-20(14-18)33-25(30)21(16-9-5-3-6-10-16)26-22(27)17-11-7-4-8-12-17/h3-15,21H,1-2H3,(H,26,27) |
| InChIKey | WHWJWHHSQQRGEW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|