C24H19NO3 — CID 71580592
methyl (2R)-2-phenyl-2-[[4-(2-phenylethynyl)benzoyl]amino]acetate (PubChem CID 71580592) has the molecular formula C24H19NO3 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl (2R)-2-phenyl-2-[[4-(2-phenylethynyl)benzoyl]amino]acetate.
| Compound Name | methyl (2R)-2-phenyl-2-[[4-(2-phenylethynyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 71580592 |
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | methyl (2R)-2-phenyl-2-[[4-(2-phenylethynyl)benzoyl]amino]acetate |
| SMILES | COC(=O)[C@H](NC(=O)c1ccc(C#Cc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H19NO3/c1-28-24(27)22(20-10-6-3-7-11-20)25-23(26)21-16-14-19(15-17-21)13-12-18-8-4-2-5-9-18/h2-11,14-17,22H,1H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | WYGUACNXIHYKNQ-JOCHJYFZSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|