C16H16N2O3 — CID 51315270
N-(2-amino-2-oxo-1-phenylethyl)-4-methoxybenzamide (PubChem CID 51315270) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)-4-methoxybenzamide.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 51315270 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C(N)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O3/c1-21-13-9-7-12(8-10-13)16(20)18-14(15(17)19)11-5-3-2-4-6-11/h2-10,14H,1H3,(H2,17,19)(H,18,20) |
| InChIKey | DAMKRITVZVHSIM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |