C20H22N2O5 — CID 119170708
4-[[2-[(4-methoxybenzoyl)amino]-2-phenylacetyl]amino]butanoic acid (PubChem CID 119170708) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 4-[[2-[(4-methoxybenzoyl)amino]-2-phenylacetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[(4-methoxybenzoyl)amino]-2-phenylacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119170708 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 4-[[2-[(4-methoxybenzoyl)amino]-2-phenylacetyl]amino]butanoic acid |
| SMILES | COc1ccc(C(=O)NC(C(=O)NCCCC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-27-16-11-9-15(10-12-16)19(25)22-18(14-6-3-2-4-7-14)20(26)21-13-5-8-17(23)24/h2-4,6-7,9-12,18H,5,8,13H2,1H3,(H,21,26)(H,22,25)(H,23,24) |
| InChIKey | VQMYANADLAXDOR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|