C22H26N2O5 — CID 119364694
(2R)-2-[[2-[(4-methoxybenzoyl)amino]-2-phenylacetyl]amino]-4-methylpentanoic acid (PubChem CID 119364694) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is (2R)-2-[[2-[(4-methoxybenzoyl)amino]-2-phenylacetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[2-[(4-methoxybenzoyl)amino]-2-phenylacetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119364694 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (2R)-2-[[2-[(4-methoxybenzoyl)amino]-2-phenylacetyl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccc(C(=O)NC(C(=O)N[C@H](CC(C)C)C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-14(2)13-18(22(27)28)23-21(26)19(15-7-5-4-6-8-15)24-20(25)16-9-11-17(29-3)12-10-16/h4-12,14,18-19H,13H2,1-3H3,(H,23,26)(H,24,25)(H,27,28)/t18-,19?/m1/s1 |
| InChIKey | IGINDUVLODGSEB-MRTLOADZSA-N |
| XLogP | 2.78 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |