C16H14NO4- — CID 6948068
(2R)-2-[(4-methoxybenzoyl)amino]-2-phenylacetate (PubChem CID 6948068) has the molecular formula C16H14NO4- and a molecular weight of 284.29 g/mol. Its IUPAC name is (2R)-2-[(4-methoxybenzoyl)amino]-2-phenylacetate.
| Compound Name | (2R)-2-[(4-methoxybenzoyl)amino]-2-phenylacetate |
|---|---|
| PubChem CID | 6948068 |
| Molecular Formula | C16H14NO4- |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (2R)-2-[(4-methoxybenzoyl)amino]-2-phenylacetate |
| SMILES | COc1ccc(C(=O)N[C@@H](C(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15NO4/c1-21-13-9-7-12(8-10-13)15(18)17-14(16(19)20)11-5-3-2-4-6-11/h2-10,14H,1H3,(H,17,18)(H,19,20)/p-1/t14-/m1/s1 |
| InChIKey | MBNRIDZSQPHJRF-CQSZACIVSA-M |
| XLogP | 0.92 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |