C20H31N3O5 — CID 11741296
(2S)-2-[[(2R)-2-amino-6-[(4-methoxybenzoyl)amino]hexanoyl]amino]-4-methylpentanoic acid (PubChem CID 11741296) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-6-[(4-methoxybenzoyl)amino]hexanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-6-[(4-methoxybenzoyl)amino]hexanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 11741296 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-6-[(4-methoxybenzoyl)amino]hexanoyl]amino]-4-methylpentanoic acid |
| SMILES | COc1ccc(C(=O)NCCCC[C@@H](N)C(=O)N[C@@H](CC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C20H31N3O5/c1-13(2)12-17(20(26)27)23-19(25)16(21)6-4-5-11-22-18(24)14-7-9-15(28-3)10-8-14/h7-10,13,16-17H,4-6,11-12,21H2,1-3H3,(H,22,24)(H,23,25)(H,26,27)/t16-,17+/m1/s1 |
| InChIKey | REBQZIPGWHGENB-SJORKVTESA-N |
| XLogP | 1.54 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|