C19H29N3O5 — CID 10091120
(2S)-2-[[(2R)-2-amino-6-[(4-methoxybenzoyl)amino]hexanoyl]amino]-3-methylbutanoic acid (PubChem CID 10091120) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-6-[(4-methoxybenzoyl)amino]hexanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-amino-6-[(4-methoxybenzoyl)amino]hexanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10091120 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-6-[(4-methoxybenzoyl)amino]hexanoyl]amino]-3-methylbutanoic acid |
| SMILES | COc1ccc(C(=O)NCCCC[C@@H](N)C(=O)N[C@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C19H29N3O5/c1-12(2)16(19(25)26)22-18(24)15(20)6-4-5-11-21-17(23)13-7-9-14(27-3)10-8-13/h7-10,12,15-16H,4-6,11,20H2,1-3H3,(H,21,23)(H,22,24)(H,25,26)/t15-,16+/m1/s1 |
| InChIKey | BPGJWXCSDQDAQA-CVEARBPZSA-N |
| XLogP | 1.15 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|