C15H23FN3O5P — CID 177135902
(2S)-2-amino-6-[[4-[dimethylamino(fluoro)phosphoryl]oxybenzoyl]amino]hexanoic acid (PubChem CID 177135902) has the molecular formula C15H23FN3O5P and a molecular weight of 375.34 g/mol. Its IUPAC name is (2S)-2-amino-6-[[4-[dimethylamino(fluoro)phosphoryl]oxybenzoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[[4-[dimethylamino(fluoro)phosphoryl]oxybenzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 177135902 |
| Molecular Formula | C15H23FN3O5P |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (2S)-2-amino-6-[[4-[dimethylamino(fluoro)phosphoryl]oxybenzoyl]amino]hexanoic acid |
| SMILES | CN(C)P(=O)(F)Oc1ccc(C(=O)NCCCC[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C15H23FN3O5P/c1-19(2)25(16,23)24-12-8-6-11(7-9-12)14(20)18-10-4-3-5-13(17)15(21)22/h6-9,13H,3-5,10,17H2,1-2H3,(H,18,20)(H,21,22)/t13-,25?/m0/s1 |
| InChIKey | FYKJPQFVTKUXPA-GLLGCSJKSA-N |
| XLogP | 2.02 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|