C16H22FN3O4 — CID 10042800
2-[[2-amino-6-[(4-fluorobenzoyl)amino]hexanoyl]-methylamino]acetic acid (PubChem CID 10042800) has the molecular formula C16H22FN3O4 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[[2-amino-6-[(4-fluorobenzoyl)amino]hexanoyl]-methylamino]acetic acid.
| Compound Name | 2-[[2-amino-6-[(4-fluorobenzoyl)amino]hexanoyl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 10042800 |
| Molecular Formula | C16H22FN3O4 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[[2-amino-6-[(4-fluorobenzoyl)amino]hexanoyl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)C(N)CCCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FN3O4/c1-20(10-14(21)22)16(24)13(18)4-2-3-9-19-15(23)11-5-7-12(17)8-6-11/h5-8,13H,2-4,9-10,18H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | BFXPXNQLLQLUTG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|