C24H31F2N3O3 — CID 160565392
N-[(5R)-5-acetamidohexyl]-4-(18F)fluoro(18F)benzamide;N-ethyl-4-(18F)fluoro(18F)benzamide (PubChem CID 160565392) has the molecular formula C24H31F2N3O3 and a molecular weight of 445.53 g/mol. Its IUPAC name is N-[(5R)-5-acetamidohexyl]-4-(18F)fluoro(18F)benzamide;N-ethyl-4-(18F)fluoro(18F)benzamide.
| Compound Name | N-[(5R)-5-acetamidohexyl]-4-(18F)fluoro(18F)benzamide;N-ethyl-4-(18F)fluoro(18F)benzamide |
|---|---|
| PubChem CID | 160565392 |
| Molecular Formula | C24H31F2N3O3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | N-[(5R)-5-acetamidohexyl]-4-(18F)fluoro(18F)benzamide;N-ethyl-4-(18F)fluoro(18F)benzamide |
| SMILES | CC(=O)N[C@H](C)CCCCNC(=O)c1ccc([18F])cc1.CCNC(=O)c1ccc([18F])cc1 |
| InChI | InChI=1S/C15H21FN2O2.C9H10FNO/c1-11(18-12(2)19)5-3-4-10-17-15(20)13-6-8-14(16)9-7-13;1-2-11-9(12)7-3-5-8(10)6-4-7/h6-9,11H,3-5,10H2,1-2H3,(H,17,20)(H,18,19);3-6H,2H2,1H3,(H,11,12)/t11-;/m1./s1/i16-1;10-1 |
| InChIKey | QZVUXYXJJGGNCU-GIXBRNFPSA-N |
| XLogP | 3.83 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|