C14H20FN3O2 — CID 47386650
N-[2-(butan-2-ylcarbamoylamino)ethyl]-4-fluorobenzamide (PubChem CID 47386650) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is N-[2-(butan-2-ylcarbamoylamino)ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-(butan-2-ylcarbamoylamino)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 47386650 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N-[2-(butan-2-ylcarbamoylamino)ethyl]-4-fluorobenzamide |
| SMILES | CCC(C)NC(=O)NCCNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FN3O2/c1-3-10(2)18-14(20)17-9-8-16-13(19)11-4-6-12(15)7-5-11/h4-7,10H,3,8-9H2,1-2H3,(H,16,19)(H2,17,18,20) |
| InChIKey | JCJDOFBORFEWDK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|