C15H21FN4O3 — CID 86861293
N-butan-2-yl-2-[[(4-fluorobenzoyl)amino]carbamoylamino]propanamide (PubChem CID 86861293) has the molecular formula C15H21FN4O3 and a molecular weight of 324.36 g/mol. Its IUPAC name is N-butan-2-yl-2-[[(4-fluorobenzoyl)amino]carbamoylamino]propanamide.
| Compound Name | N-butan-2-yl-2-[[(4-fluorobenzoyl)amino]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 86861293 |
| Molecular Formula | C15H21FN4O3 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-butan-2-yl-2-[[(4-fluorobenzoyl)amino]carbamoylamino]propanamide |
| SMILES | CCC(C)NC(=O)C(C)NC(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN4O3/c1-4-9(2)17-13(21)10(3)18-15(23)20-19-14(22)11-5-7-12(16)8-6-11/h5-10H,4H2,1-3H3,(H,17,21)(H,19,22)(H2,18,20,23) |
| InChIKey | XQSIYDLMDXYOCT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|