C16H22F3N3O2 — CID 94806328
(2R)-N-[(2R)-butan-2-yl]-2-[[4-(trifluoromethyl)phenyl]methylcarbamoylamino]propanamide (PubChem CID 94806328) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is (2R)-N-[(2R)-butan-2-yl]-2-[[4-(trifluoromethyl)phenyl]methylcarbamoylamino]propanamide.
| Compound Name | (2R)-N-[(2R)-butan-2-yl]-2-[[4-(trifluoromethyl)phenyl]methylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 94806328 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2R)-N-[(2R)-butan-2-yl]-2-[[4-(trifluoromethyl)phenyl]methylcarbamoylamino]propanamide |
| SMILES | CC[C@@H](C)NC(=O)[C@@H](C)NC(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-4-10(2)21-14(23)11(3)22-15(24)20-9-12-5-7-13(8-6-12)16(17,18)19/h5-8,10-11H,4,9H2,1-3H3,(H,21,23)(H2,20,22,24)/t10-,11-/m1/s1 |
| InChIKey | IJSPJUCUZXXALG-GHMZBOCLSA-N |
| XLogP | 2.81 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |